About 2,3,5-trimethyl-4-propan-2-yl-1,2-dihydroimidazole
2,3,5-trimethyl-4-propan-2-yl-1,2-dihydroimidazole (PubChem CID 168982721) has the molecular formula C9H18N2
and a molecular weight of 154.26 g/mol. Its IUPAC name is 2,3,5-trimethyl-4-propan-2-yl-1,2-dihydroimidazole.
Analyze 2,3,5-trimethyl-4-propan-2-yl-1,2-dihydroimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,5-trimethyl-4-propan-2-yl-1,2-dihydroimidazole?
The IUPAC name of 2,3,5-trimethyl-4-propan-2-yl-1,2-dihydroimidazole (CID 168982721) is 2,3,5-trimethyl-4-propan-2-yl-1,2-dihydroimidazole.
What is the SMILES notation for 2,3,5-trimethyl-4-propan-2-yl-1,2-dihydroimidazole?
The canonical SMILES for 2,3,5-trimethyl-4-propan-2-yl-1,2-dihydroimidazole is CC1=C(C(C)C)N(C)C(C)N1.
What is the InChIKey of 2,3,5-trimethyl-4-propan-2-yl-1,2-dihydroimidazole?
The InChIKey is CUGPBOOZUJQISR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2/c1-6(2)9-7(3)10-8(4)11(9)5/h6,8,10H,1-5H3.
What are the key properties of 2,3,5-trimethyl-4-propan-2-yl-1,2-dihydroimidazole?
2,3,5-trimethyl-4-propan-2-yl-1,2-dihydroimidazole has a molecular weight of 154.26 g/mol, XLogP of 1.75, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,5-trimethyl-4-propan-2-yl-1,2-dihydroimidazole is sourced from PubChem (CID 168982721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).