C18H13F3N6O2 — CID 168984334
(E)-3-[4-[2-cyclopropyl-6-(trifluoromethyl)-4-pyridinyl]triazol-2-yl]-2-pyrimidin-5-ylprop-2-enoic acid (PubChem CID 168984334) has the molecular formula C18H13F3N6O2 and a molecular weight of 402.34 g/mol. Its IUPAC name is (E)-3-[4-[2-cyclopropyl-6-(trifluoromethyl)-4-pyridinyl]triazol-2-yl]-2-pyrimidin-5-ylprop-2-enoic acid.
| Compound Name | (E)-3-[4-[2-cyclopropyl-6-(trifluoromethyl)-4-pyridinyl]triazol-2-yl]-2-pyrimidin-5-ylprop-2-enoic acid |
|---|---|
| PubChem CID | 168984334 |
| Molecular Formula | C18H13F3N6O2 |
| Molecular Weight | 402.34 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | (E)-3-[4-[2-cyclopropyl-6-(trifluoromethyl)-4-pyridinyl]triazol-2-yl]-2-pyrimidin-5-ylprop-2-enoic acid |
| SMILES | O=C(O)/C(=C/n1ncc(-c2cc(C3CC3)nc(C(F)(F)F)c2)n1)c1cncnc1 |
| InChI | InChI=1S/C18H13F3N6O2/c19-18(20,21)16-4-11(3-14(25-16)10-1-2-10)15-7-24-27(26-15)8-13(17(28)29)12-5-22-9-23-6-12/h3-10H,1-2H2,(H,28,29)/b13-8+ |
| InChIKey | DWZMOTDFIPNAKL-MDWZMJQESA-N |
| XLogP | 3.11 |
| TPSA | 106.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.34 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|