C28H33N5O6S — CID 168985949
2'-[[2-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]cyclohexyl]methyl]spiro[1,3-dioxolane-2,4'-4a,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine]-1',3',4,5-tetrone (PubChem CID 168985949) has the molecular formula C28H33N5O6S and a molecular weight of 567.67 g/mol. Its IUPAC name is 2'-[[2-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]cyclohexyl]methyl]spiro[1,3-dioxolane-2,4'-4a,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine]-1',3',4,5-tetrone.
| Compound Name | 2'-[[2-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]cyclohexyl]methyl]spiro[1,3-dioxolane-2,4'-4a,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine]-1',3',4,5-tetrone |
|---|---|
| PubChem CID | 168985949 |
| Molecular Formula | C28H33N5O6S |
| Molecular Weight | 567.67 g/mol |
| Exact Mass | 567.22 |
| IUPAC Name | 2'-[[2-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]cyclohexyl]methyl]spiro[1,3-dioxolane-2,4'-4a,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine]-1',3',4,5-tetrone |
| SMILES | O=C1OC2(OC1=O)C(=O)N(CC1CCCCC1CN1CCN(c3nsc4ccccc34)CC1)C(=O)N1CCCC12 |
| InChI | InChI=1S/C28H33N5O6S/c34-24-25(35)39-28(38-24)22-10-5-11-32(22)27(37)33(26(28)36)17-19-7-2-1-6-18(19)16-30-12-14-31(15-13-30)23-20-8-3-4-9-21(20)40-29-23/h3-4,8-9,18-19,22H,1-2,5-7,10-17H2 |
| InChIKey | NNUUGEFTULNFOZ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 112.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.67 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|