C15H14IN — CID 168986255
11-iodo-2-methyl-5,6-dihydrobenzo[b][1]benzazepine (PubChem CID 168986255) has the molecular formula C15H14IN and a molecular weight of 335.19 g/mol. Its IUPAC name is 11-iodo-2-methyl-5,6-dihydrobenzo[b][1]benzazepine.
| Compound Name | 11-iodo-2-methyl-5,6-dihydrobenzo[b][1]benzazepine |
|---|---|
| PubChem CID | 168986255 |
| Molecular Formula | C15H14IN |
| Molecular Weight | 335.19 g/mol |
| Exact Mass | 335.02 |
| IUPAC Name | 11-iodo-2-methyl-5,6-dihydrobenzo[b][1]benzazepine |
| SMILES | Cc1ccc2c(c1)N(I)c1ccccc1CC2 |
| InChI | InChI=1S/C15H14IN/c1-11-6-7-13-9-8-12-4-2-3-5-14(12)17(16)15(13)10-11/h2-7,10H,8-9H2,1H3 |
| InChIKey | HFLANMOIZWZQCB-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.19 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|