C17H35N3O5 — CID 168986634
2-[2-[2-(2-ethoxyethoxy)ethoxy]ethyl-[2-oxo-2-(propylamino)ethyl]amino]-N-ethylacetamide (PubChem CID 168986634) has the molecular formula C17H35N3O5 and a molecular weight of 361.48 g/mol. Its IUPAC name is 2-[2-[2-(2-ethoxyethoxy)ethoxy]ethyl-[2-oxo-2-(propylamino)ethyl]amino]-N-ethylacetamide.
| Compound Name | 2-[2-[2-(2-ethoxyethoxy)ethoxy]ethyl-[2-oxo-2-(propylamino)ethyl]amino]-N-ethylacetamide |
|---|---|
| PubChem CID | 168986634 |
| Molecular Formula | C17H35N3O5 |
| Molecular Weight | 361.48 g/mol |
| Exact Mass | 361.26 |
| IUPAC Name | 2-[2-[2-(2-ethoxyethoxy)ethoxy]ethyl-[2-oxo-2-(propylamino)ethyl]amino]-N-ethylacetamide |
| SMILES | CCCNC(=O)CN(CCOCCOCCOCC)CC(=O)NCC |
| InChI | InChI=1S/C17H35N3O5/c1-4-7-19-17(22)15-20(14-16(21)18-5-2)8-9-24-12-13-25-11-10-23-6-3/h4-15H2,1-3H3,(H,18,21)(H,19,22) |
| InChIKey | YDHPNUJAUWEGRF-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.48 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|