C28H31F2N7O3 — CID 168988208
N-[2-[(3R)-3-aminopyrrolidin-1-yl]-3-methyl-4-[(methylideneamino)-(oxan-4-yl)amino]phenyl]-1-(2,6-difluorophenyl)-6-oxopyridazine-3-carboxamide (PubChem CID 168988208) has the molecular formula C28H31F2N7O3 and a molecular weight of 551.60 g/mol. Its IUPAC name is N-[2-[(3R)-3-aminopyrrolidin-1-yl]-3-methyl-4-[(methylideneamino)-(oxan-4-yl)amino]phenyl]-1-(2,6-difluorophenyl)-6-oxopyridazine-3-carboxamide.
| Compound Name | N-[2-[(3R)-3-aminopyrrolidin-1-yl]-3-methyl-4-[(methylideneamino)-(oxan-4-yl)amino]phenyl]-1-(2,6-difluorophenyl)-6-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 168988208 |
| Molecular Formula | C28H31F2N7O3 |
| Molecular Weight | 551.60 g/mol |
| Exact Mass | 551.25 |
| IUPAC Name | N-[2-[(3R)-3-aminopyrrolidin-1-yl]-3-methyl-4-[(methylideneamino)-(oxan-4-yl)amino]phenyl]-1-(2,6-difluorophenyl)-6-oxopyridazine-3-carboxamide |
| SMILES | C=NN(c1ccc(NC(=O)c2ccc(=O)n(-c3c(F)cccc3F)n2)c(N2CC[C@@H](N)C2)c1C)C1CCOCC1 |
| InChI | InChI=1S/C28H31F2N7O3/c1-17-24(36(32-2)19-11-14-40-15-12-19)8-6-22(26(17)35-13-10-18(31)16-35)33-28(39)23-7-9-25(38)37(34-23)27-20(29)4-3-5-21(27)30/h3-9,18-19H,2,10-16,31H2,1H3,(H,33,39)/t18-/m1/s1 |
| InChIKey | KSXZOOCXAMTROU-GOSISDBHSA-N |
| XLogP | 3.21 |
| TPSA | 118.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.60 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|