C21H22N2O4 — CID 168994437
ethyl 4-(4-oxo-3H-phthalazin-1-yl)-2-phenylmethoxybutanoate (PubChem CID 168994437) has the molecular formula C21H22N2O4 and a molecular weight of 366.42 g/mol. Its IUPAC name is ethyl 4-(4-oxo-3H-phthalazin-1-yl)-2-phenylmethoxybutanoate.
| Compound Name | ethyl 4-(4-oxo-3H-phthalazin-1-yl)-2-phenylmethoxybutanoate |
|---|---|
| PubChem CID | 168994437 |
| Molecular Formula | C21H22N2O4 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | ethyl 4-(4-oxo-3H-phthalazin-1-yl)-2-phenylmethoxybutanoate |
| SMILES | CCOC(=O)C(CCc1n[nH]c(=O)c2ccccc12)OCc1ccccc1 |
| InChI | InChI=1S/C21H22N2O4/c1-2-26-21(25)19(27-14-15-8-4-3-5-9-15)13-12-18-16-10-6-7-11-17(16)20(24)23-22-18/h3-11,19H,2,12-14H2,1H3,(H,23,24) |
| InChIKey | KBNBSTWMKWSMHE-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 81.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |