C15H8BClN4O5 — CID 168994803
[5-[5-(6-chloro-2-oxochromen-3-yl)-1,2,4-oxadiazol-3-yl]pyrazin-2-yl]boronic acid (PubChem CID 168994803) has the molecular formula C15H8BClN4O5 and a molecular weight of 370.52 g/mol. Its IUPAC name is [5-[5-(6-chloro-2-oxochromen-3-yl)-1,2,4-oxadiazol-3-yl]pyrazin-2-yl]boronic acid.
| Compound Name | [5-[5-(6-chloro-2-oxochromen-3-yl)-1,2,4-oxadiazol-3-yl]pyrazin-2-yl]boronic acid |
|---|---|
| PubChem CID | 168994803 |
| Molecular Formula | C15H8BClN4O5 |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.03 |
| IUPAC Name | [5-[5-(6-chloro-2-oxochromen-3-yl)-1,2,4-oxadiazol-3-yl]pyrazin-2-yl]boronic acid |
| SMILES | O=c1oc2ccc(Cl)cc2cc1-c1nc(-c2cnc(B(O)O)cn2)no1 |
| InChI | InChI=1S/C15H8BClN4O5/c17-8-1-2-11-7(3-8)4-9(15(22)25-11)14-20-13(21-26-14)10-5-19-12(6-18-10)16(23)24/h1-6,23-24H |
| InChIKey | WLVGHXZEYBMVKK-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 135.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|