C18H17N3O4 — CID 168994885
methanol;6-methyl-3-[3-(5-methyl-1H-pyrrol-2-yl)-1,2,4-oxadiazol-5-yl]chromen-2-one (PubChem CID 168994885) has the molecular formula C18H17N3O4 and a molecular weight of 339.35 g/mol. Its IUPAC name is methanol;6-methyl-3-[3-(5-methyl-1H-pyrrol-2-yl)-1,2,4-oxadiazol-5-yl]chromen-2-one.
| Compound Name | methanol;6-methyl-3-[3-(5-methyl-1H-pyrrol-2-yl)-1,2,4-oxadiazol-5-yl]chromen-2-one |
|---|---|
| PubChem CID | 168994885 |
| Molecular Formula | C18H17N3O4 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | methanol;6-methyl-3-[3-(5-methyl-1H-pyrrol-2-yl)-1,2,4-oxadiazol-5-yl]chromen-2-one |
| SMILES | CO.Cc1ccc2oc(=O)c(-c3nc(-c4ccc(C)[nH]4)no3)cc2c1 |
| InChI | InChI=1S/C17H13N3O3.CH4O/c1-9-3-6-14-11(7-9)8-12(17(21)22-14)16-19-15(20-23-16)13-5-4-10(2)18-13;1-2/h3-8,18H,1-2H3;2H,1H3 |
| InChIKey | FPRLHKAZGYECKX-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 105.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|