C23H20BClN2O5 — CID 168994815
6-chloro-3-[3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,2,4-oxadiazol-5-yl]chromen-2-one (PubChem CID 168994815) has the molecular formula C23H20BClN2O5 and a molecular weight of 450.69 g/mol. Its IUPAC name is 6-chloro-3-[3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,2,4-oxadiazol-5-yl]chromen-2-one.
| Compound Name | 6-chloro-3-[3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,2,4-oxadiazol-5-yl]chromen-2-one |
|---|---|
| PubChem CID | 168994815 |
| Molecular Formula | C23H20BClN2O5 |
| Molecular Weight | 450.69 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | 6-chloro-3-[3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,2,4-oxadiazol-5-yl]chromen-2-one |
| SMILES | CC1(C)OB(c2cccc(-c3noc(-c4cc5cc(Cl)ccc5oc4=O)n3)c2)OC1(C)C |
| InChI | InChI=1S/C23H20BClN2O5/c1-22(2)23(3,4)32-24(31-22)15-7-5-6-13(10-15)19-26-20(30-27-19)17-12-14-11-16(25)8-9-18(14)29-21(17)28/h5-12H,1-4H3 |
| InChIKey | AUJHIMQGAPHADD-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 87.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.69 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|