C19H22O4 — CID 168994914
3-[(E)-dec-8-en-4-ynoyl]oxy-2-phenylpropanoic acid (PubChem CID 168994914) has the molecular formula C19H22O4 and a molecular weight of 314.38 g/mol. Its IUPAC name is 3-[(E)-dec-8-en-4-ynoyl]oxy-2-phenylpropanoic acid.
| Compound Name | 3-[(E)-dec-8-en-4-ynoyl]oxy-2-phenylpropanoic acid |
|---|---|
| PubChem CID | 168994914 |
| Molecular Formula | C19H22O4 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 3-[(E)-dec-8-en-4-ynoyl]oxy-2-phenylpropanoic acid |
| SMILES | C/C=C/CCC#CCCC(=O)OCC(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C19H22O4/c1-2-3-4-5-6-7-11-14-18(20)23-15-17(19(21)22)16-12-9-8-10-13-16/h2-3,8-10,12-13,17H,4-5,11,14-15H2,1H3,(H,21,22)/b3-2+ |
| InChIKey | PVDWNZGWYDMNNU-NSCUHMNNSA-N |
| XLogP | 3.54 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|