C36H61NO4 — CID 168995015
bicyclo[3.2.1]octane;methanamine;3-[(Z)-octadec-9-enoyl]oxy-2-phenylpropanoic acid (PubChem CID 168995015) has the molecular formula C36H61NO4 and a molecular weight of 571.89 g/mol. Its IUPAC name is bicyclo[3.2.1]octane;methanamine;3-[(Z)-octadec-9-enoyl]oxy-2-phenylpropanoic acid.
| Compound Name | bicyclo[3.2.1]octane;methanamine;3-[(Z)-octadec-9-enoyl]oxy-2-phenylpropanoic acid |
|---|---|
| PubChem CID | 168995015 |
| Molecular Formula | C36H61NO4 |
| Molecular Weight | 571.89 g/mol |
| Exact Mass | 571.46 |
| IUPAC Name | bicyclo[3.2.1]octane;methanamine;3-[(Z)-octadec-9-enoyl]oxy-2-phenylpropanoic acid |
| SMILES | C1CC2CCC(C1)C2.CCCCCCCC/C=C\CCCCCCCC(=O)OCC(C(=O)O)c1ccccc1.CN |
| InChI | InChI=1S/C27H42O4.C8H14.CH5N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-19-22-26(28)31-23-25(27(29)30)24-20-17-16-18-21-24;1-2-7-4-5-8(3-1)6-7;1-2/h9-10,16-18,20-21,25H,2-8,11-15,19,22-23H2,1H3,(H,29,30);7-8H,1-6H2;2H2,1H3/b10-9-;; |
| InChIKey | HQRBTTKJUNSMHD-XXAVUKJNSA-N |
| XLogP | 9.60 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.89 |
| LogP ≤ 5 | 9.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|