C35H57NO4 — CID 168994946
8-methyl-8-azabicyclo[3.2.1]octane;3-[(E)-octadec-11-enoyl]oxy-2-phenylpropanoic acid (PubChem CID 168994946) has the molecular formula C35H57NO4 and a molecular weight of 555.84 g/mol. Its IUPAC name is 8-methyl-8-azabicyclo[3.2.1]octane;3-[(E)-octadec-11-enoyl]oxy-2-phenylpropanoic acid.
| Compound Name | 8-methyl-8-azabicyclo[3.2.1]octane;3-[(E)-octadec-11-enoyl]oxy-2-phenylpropanoic acid |
|---|---|
| PubChem CID | 168994946 |
| Molecular Formula | C35H57NO4 |
| Molecular Weight | 555.84 g/mol |
| Exact Mass | 555.43 |
| IUPAC Name | 8-methyl-8-azabicyclo[3.2.1]octane;3-[(E)-octadec-11-enoyl]oxy-2-phenylpropanoic acid |
| SMILES | CCCCCC/C=C/CCCCCCCCCC(=O)OCC(C(=O)O)c1ccccc1.CN1C2CCCC1CC2 |
| InChI | InChI=1S/C27H42O4.C8H15N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-19-22-26(28)31-23-25(27(29)30)24-20-17-16-18-21-24;1-9-7-3-2-4-8(9)6-5-7/h7-8,16-18,20-21,25H,2-6,9-15,19,22-23H2,1H3,(H,29,30);7-8H,2-6H2,1H3/b8-7+; |
| InChIKey | OARPZMKPIVQXBA-USRGLUTNSA-N |
| XLogP | 9.07 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.84 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|