C27H43NO4 — CID 168994981
3-decanoyloxy-2-phenylpropanoic acid;8-methyl-8-azabicyclo[3.2.1]octane (PubChem CID 168994981) has the molecular formula C27H43NO4 and a molecular weight of 445.64 g/mol. Its IUPAC name is 3-decanoyloxy-2-phenylpropanoic acid;8-methyl-8-azabicyclo[3.2.1]octane.
| Compound Name | 3-decanoyloxy-2-phenylpropanoic acid;8-methyl-8-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 168994981 |
| Molecular Formula | C27H43NO4 |
| Molecular Weight | 445.64 g/mol |
| Exact Mass | 445.32 |
| IUPAC Name | 3-decanoyloxy-2-phenylpropanoic acid;8-methyl-8-azabicyclo[3.2.1]octane |
| SMILES | CCCCCCCCCC(=O)OCC(C(=O)O)c1ccccc1.CN1C2CCCC1CC2 |
| InChI | InChI=1S/C19H28O4.C8H15N/c1-2-3-4-5-6-7-11-14-18(20)23-15-17(19(21)22)16-12-9-8-10-13-16;1-9-7-3-2-4-8(9)6-5-7/h8-10,12-13,17H,2-7,11,14-15H2,1H3,(H,21,22);7-8H,2-6H2,1H3 |
| InChIKey | PDGIMZYSLGPWPR-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.64 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|