C25H35NO4 — CID 174059046
[3-[[(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]oxy]-3-oxo-2-phenylpropyl] oct-3-enoate (PubChem CID 174059046) has the molecular formula C25H35NO4 and a molecular weight of 413.56 g/mol. Its IUPAC name is [3-[[(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]oxy]-3-oxo-2-phenylpropyl] oct-3-enoate.
| Compound Name | [3-[[(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]oxy]-3-oxo-2-phenylpropyl] oct-3-enoate |
|---|---|
| PubChem CID | 174059046 |
| Molecular Formula | C25H35NO4 |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.26 |
| IUPAC Name | [3-[[(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]oxy]-3-oxo-2-phenylpropyl] oct-3-enoate |
| SMILES | CCCCC=CCC(=O)OCC(C(=O)OC1C[C@H]2CC[C@@H](C1)N2C)c1ccccc1 |
| InChI | InChI=1S/C25H35NO4/c1-3-4-5-6-10-13-24(27)29-18-23(19-11-8-7-9-12-19)25(28)30-22-16-20-14-15-21(17-22)26(20)2/h6-12,20-23H,3-5,13-18H2,1-2H3/t20-,21+,22?,23? |
| InChIKey | BBDFAVBEXGAFLI-OIRDZHBESA-N |
| XLogP | 4.62 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|