C21H17N5O4S3 — CID 16899505
2-[2-[2-(4-methylanilino)-2-oxoethyl]sulfanyl-1,3-thiazol-4-yl]-N-(6-nitro-1,3-benzothiazol-2-yl)acetamide (PubChem CID 16899505) has the molecular formula C21H17N5O4S3 and a molecular weight of 499.60 g/mol. Its IUPAC name is 2-[2-[2-(4-methylanilino)-2-oxoethyl]sulfanyl-1,3-thiazol-4-yl]-N-(6-nitro-1,3-benzothiazol-2-yl)acetamide.
| Compound Name | 2-[2-[2-(4-methylanilino)-2-oxoethyl]sulfanyl-1,3-thiazol-4-yl]-N-(6-nitro-1,3-benzothiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 16899505 |
| Molecular Formula | C21H17N5O4S3 |
| Molecular Weight | 499.60 g/mol |
| Exact Mass | 499.04 |
| IUPAC Name | 2-[2-[2-(4-methylanilino)-2-oxoethyl]sulfanyl-1,3-thiazol-4-yl]-N-(6-nitro-1,3-benzothiazol-2-yl)acetamide |
| SMILES | Cc1ccc(NC(=O)CSc2nc(CC(=O)Nc3nc4ccc([N+](=O)[O-])cc4s3)cs2)cc1 |
| InChI | InChI=1S/C21H17N5O4S3/c1-12-2-4-13(5-3-12)22-19(28)11-32-21-23-14(10-31-21)8-18(27)25-20-24-16-7-6-15(26(29)30)9-17(16)33-20/h2-7,9-10H,8,11H2,1H3,(H,22,28)(H,24,25,27) |
| InChIKey | BAVGLOPLJRUGFH-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 127.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.60 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|