C16H21F3O4S — CID 168997080
3-[4-(3-methylbutoxy)-2-(trifluoromethyl)phenyl]-3-methylsulfonyloxetane (PubChem CID 168997080) has the molecular formula C16H21F3O4S and a molecular weight of 366.40 g/mol. Its IUPAC name is 3-[4-(3-methylbutoxy)-2-(trifluoromethyl)phenyl]-3-methylsulfonyloxetane.
| Compound Name | 3-[4-(3-methylbutoxy)-2-(trifluoromethyl)phenyl]-3-methylsulfonyloxetane |
|---|---|
| PubChem CID | 168997080 |
| Molecular Formula | C16H21F3O4S |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | 3-[4-(3-methylbutoxy)-2-(trifluoromethyl)phenyl]-3-methylsulfonyloxetane |
| SMILES | CC(C)CCOc1ccc(C2(S(C)(=O)=O)COC2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H21F3O4S/c1-11(2)6-7-23-12-4-5-13(14(8-12)16(17,18)19)15(9-22-10-15)24(3,20)21/h4-5,8,11H,6-7,9-10H2,1-3H3 |
| InChIKey | AQVLNKXKSFCNBS-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |