C14H20F3NO2S — CID 169031056
methyl-[4-(3-methylbutoxy)-2-(trifluoromethyl)phenyl]-methylimino-oxo-λ6-sulfane (PubChem CID 169031056) has the molecular formula C14H20F3NO2S and a molecular weight of 323.38 g/mol. Its IUPAC name is methyl-[4-(3-methylbutoxy)-2-(trifluoromethyl)phenyl]-methylimino-oxo-λ6-sulfane.
| Compound Name | methyl-[4-(3-methylbutoxy)-2-(trifluoromethyl)phenyl]-methylimino-oxo-λ6-sulfane |
|---|---|
| PubChem CID | 169031056 |
| Molecular Formula | C14H20F3NO2S |
| Molecular Weight | 323.38 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | methyl-[4-(3-methylbutoxy)-2-(trifluoromethyl)phenyl]-methylimino-oxo-λ6-sulfane |
| SMILES | CN=S(C)(=O)c1ccc(OCCC(C)C)cc1C(F)(F)F |
| InChI | InChI=1S/C14H20F3NO2S/c1-10(2)7-8-20-11-5-6-13(21(4,19)18-3)12(9-11)14(15,16)17/h5-6,9-10H,7-8H2,1-4H3 |
| InChIKey | KFXVAAGSNJJVTJ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.38 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |