C18H25N3S — CID 169005099
2-(4-pyrrolidin-1-ylbutylsulfanyl)spiro[1H-quinazoline-4,1'-cyclopropane] (PubChem CID 169005099) has the molecular formula C18H25N3S and a molecular weight of 315.49 g/mol. Its IUPAC name is 2-(4-pyrrolidin-1-ylbutylsulfanyl)spiro[1H-quinazoline-4,1'-cyclopropane].
| Compound Name | 2-(4-pyrrolidin-1-ylbutylsulfanyl)spiro[1H-quinazoline-4,1'-cyclopropane] |
|---|---|
| PubChem CID | 169005099 |
| Molecular Formula | C18H25N3S |
| Molecular Weight | 315.49 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | 2-(4-pyrrolidin-1-ylbutylsulfanyl)spiro[1H-quinazoline-4,1'-cyclopropane] |
| SMILES | c1ccc2c(c1)NC(SCCCCN1CCCC1)=NC21CC1 |
| InChI | InChI=1S/C18H25N3S/c1-2-8-16-15(7-1)18(9-10-18)20-17(19-16)22-14-6-5-13-21-11-3-4-12-21/h1-2,7-8H,3-6,9-14H2,(H,19,20) |
| InChIKey | JOBZUDOQAUJEDJ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.49 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|