C25H31BF4N2O3 — CID 169008744
1-fluoro-3-(oxan-2-yl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-7-(2,2,2-trifluoroethyl)-9,10-dihydro-8H-cyclohepta[e]indazole (PubChem CID 169008744) has the molecular formula C25H31BF4N2O3 and a molecular weight of 494.34 g/mol. Its IUPAC name is 1-fluoro-3-(oxan-2-yl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-7-(2,2,2-trifluoroethyl)-9,10-dihydro-8H-cyclohepta[e]indazole.
| Compound Name | 1-fluoro-3-(oxan-2-yl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-7-(2,2,2-trifluoroethyl)-9,10-dihydro-8H-cyclohepta[e]indazole |
|---|---|
| PubChem CID | 169008744 |
| Molecular Formula | C25H31BF4N2O3 |
| Molecular Weight | 494.34 g/mol |
| Exact Mass | 494.24 |
| IUPAC Name | 1-fluoro-3-(oxan-2-yl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-7-(2,2,2-trifluoroethyl)-9,10-dihydro-8H-cyclohepta[e]indazole |
| SMILES | CC1(C)OB(C2=C(CC(F)(F)F)CCCc3c2ccc2c3c(F)nn2C2CCCCO2)OC1(C)C |
| InChI | InChI=1S/C25H31BF4N2O3/c1-23(2)24(3,4)35-26(34-23)21-15(14-25(28,29)30)8-7-9-16-17(21)11-12-18-20(16)22(27)31-32(18)19-10-5-6-13-33-19/h11-12,19H,5-10,13-14H2,1-4H3 |
| InChIKey | LLTFWNUHKODYGF-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.34 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|