C29H36FN5O3 — CID 170705610
6-[5-[4-(dimethoxymethyl)piperidin-1-yl]pyrazin-2-yl]-1-fluoro-3-(oxan-2-yl)-9,10-dihydro-8H-cyclohepta[e]indazole (PubChem CID 170705610) has the molecular formula C29H36FN5O3 and a molecular weight of 521.64 g/mol. Its IUPAC name is 6-[5-[4-(dimethoxymethyl)piperidin-1-yl]pyrazin-2-yl]-1-fluoro-3-(oxan-2-yl)-9,10-dihydro-8H-cyclohepta[e]indazole.
| Compound Name | 6-[5-[4-(dimethoxymethyl)piperidin-1-yl]pyrazin-2-yl]-1-fluoro-3-(oxan-2-yl)-9,10-dihydro-8H-cyclohepta[e]indazole |
|---|---|
| PubChem CID | 170705610 |
| Molecular Formula | C29H36FN5O3 |
| Molecular Weight | 521.64 g/mol |
| Exact Mass | 521.28 |
| IUPAC Name | 6-[5-[4-(dimethoxymethyl)piperidin-1-yl]pyrazin-2-yl]-1-fluoro-3-(oxan-2-yl)-9,10-dihydro-8H-cyclohepta[e]indazole |
| SMILES | COC(OC)C1CCN(c2cnc(C3=CCCCc4c3ccc3c4c(F)nn3C3CCCCO3)cn2)CC1 |
| InChI | InChI=1S/C29H36FN5O3/c1-36-29(37-2)19-12-14-34(15-13-19)25-18-31-23(17-32-25)21-7-3-4-8-22-20(21)10-11-24-27(22)28(30)33-35(24)26-9-5-6-16-38-26/h7,10-11,17-19,26,29H,3-6,8-9,12-16H2,1-2H3 |
| InChIKey | YWIYYXRFYXMZIF-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 74.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.64 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|