C6H11O5P — CID 169009570
2-(oxolan-2-yloxy)-1,3,2λ5-dioxaphospholane 2-oxide (PubChem CID 169009570) has the molecular formula C6H11O5P and a molecular weight of 194.12 g/mol. Its IUPAC name is 2-(oxolan-2-yloxy)-1,3,2λ5-dioxaphospholane 2-oxide.
| Compound Name | 2-(oxolan-2-yloxy)-1,3,2λ5-dioxaphospholane 2-oxide |
|---|---|
| PubChem CID | 169009570 |
| Molecular Formula | C6H11O5P |
| Molecular Weight | 194.12 g/mol |
| Exact Mass | 194.03 |
| IUPAC Name | 2-(oxolan-2-yloxy)-1,3,2λ5-dioxaphospholane 2-oxide |
| SMILES | O=P1(OC2CCCO2)OCCO1 |
| InChI | InChI=1S/C6H11O5P/c7-12(9-4-5-10-12)11-6-2-1-3-8-6/h6H,1-5H2 |
| InChIKey | ADIQZWBGRRVVQR-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.12 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|