C11H20O3 — CID 169012978
4-[2-(1-hydroxyethoxy)propan-2-yl]hexa-1,5-dien-3-ol (PubChem CID 169012978) has the molecular formula C11H20O3 and a molecular weight of 200.28 g/mol. Its IUPAC name is 4-[2-(1-hydroxyethoxy)propan-2-yl]hexa-1,5-dien-3-ol.
| Compound Name | 4-[2-(1-hydroxyethoxy)propan-2-yl]hexa-1,5-dien-3-ol |
|---|---|
| PubChem CID | 169012978 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | 4-[2-(1-hydroxyethoxy)propan-2-yl]hexa-1,5-dien-3-ol |
| SMILES | C=CC(O)C(C=C)C(C)(C)OC(C)O |
| InChI | InChI=1S/C11H20O3/c1-6-9(10(13)7-2)11(4,5)14-8(3)12/h6-10,12-13H,1-2H2,3-5H3 |
| InChIKey | IPEFHETWYHAWPS-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|