C44H43IrN3-2 — CID 169015452
CID 169015452 (PubChem CID 169015452) has the molecular formula C44H43IrN3-2 and a molecular weight of 806.07 g/mol.
| Compound Name | CID 169015452 |
|---|---|
| PubChem CID | 169015452 |
| Molecular Formula | C44H43IrN3-2 |
| Molecular Weight | 806.07 g/mol |
| Exact Mass | 806.31 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1c[c-]c(-c2ccc(C(C)(C)C)cn2)cc1.CC(C)(C)c1c[c-]c2c3nccc4ccc5c6ccccc6n(c2c1)c5c43.[Ir] |
| InChI | InChI=1S/C25H19N2.C19H24N.Ir/c1-25(2,3)16-9-11-19-21(14-16)27-20-7-5-4-6-17(20)18-10-8-15-12-13-26-23(19)22(15)24(18)27;1-18(2,3)15-9-7-14(8-10-15)17-12-11-16(13-20-17)19(4,5)6;/h4-10,12-14H,1-3H3;7,9-13H,1-6H3;/q2*-1; |
| InChIKey | FXPRTHCXQBJYSB-UHFFFAOYSA-N |
| XLogP | 11.62 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.07 |
| LogP ≤ 5 | 11.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|