C26H25N2Si+ — CID 169015460
(6,9-dimethyl-1-aza-9-azoniahexacyclo[10.9.2.02,7.08,23.015,22.016,21]tricosa-2,4,6,8,10,12(23),13,15(22),16,18,20-undecaen-11-yl)-trimethylsilane (PubChem CID 169015460) has the molecular formula C26H25N2Si+ and a molecular weight of 393.59 g/mol. Its IUPAC name is (6,9-dimethyl-1-aza-9-azoniahexacyclo[10.9.2.02,7.08,23.015,22.016,21]tricosa-2,4,6,8,10,12(23),13,15(22),16,18,20-undecaen-11-yl)-trimethylsilane.
| Compound Name | (6,9-dimethyl-1-aza-9-azoniahexacyclo[10.9.2.02,7.08,23.015,22.016,21]tricosa-2,4,6,8,10,12(23),13,15(22),16,18,20-undecaen-11-yl)-trimethylsilane |
|---|---|
| PubChem CID | 169015460 |
| Molecular Formula | C26H25N2Si+ |
| Molecular Weight | 393.59 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | (6,9-dimethyl-1-aza-9-azoniahexacyclo[10.9.2.02,7.08,23.015,22.016,21]tricosa-2,4,6,8,10,12(23),13,15(22),16,18,20-undecaen-11-yl)-trimethylsilane |
| SMILES | Cc1cccc2c1c1c3c(ccc4c5ccccc5n2c43)c([Si](C)(C)C)c[n+]1C |
| InChI | InChI=1S/C26H25N2Si/c1-16-9-8-12-21-23(16)26-24-19(22(15-27(26)2)29(3,4)5)14-13-18-17-10-6-7-11-20(17)28(21)25(18)24/h6-15H,1-5H3/q+1 |
| InChIKey | ROFCFERXPBZMLI-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 8.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.59 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|