C21H30O6 — CID 169019327
(2E)-2-[[4,5-bis(hydroxymethyl)-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl]methylidene]undecanoic acid (PubChem CID 169019327) has the molecular formula C21H30O6 and a molecular weight of 378.47 g/mol. Its IUPAC name is (2E)-2-[[4,5-bis(hydroxymethyl)-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl]methylidene]undecanoic acid.
| Compound Name | (2E)-2-[[4,5-bis(hydroxymethyl)-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl]methylidene]undecanoic acid |
|---|---|
| PubChem CID | 169019327 |
| Molecular Formula | C21H30O6 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | (2E)-2-[[4,5-bis(hydroxymethyl)-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl]methylidene]undecanoic acid |
| SMILES | CCCCCCCCC/C(=C\C1=C(C)C(=O)C(CO)=C(CO)C1=O)C(=O)O |
| InChI | InChI=1S/C21H30O6/c1-3-4-5-6-7-8-9-10-15(21(26)27)11-16-14(2)19(24)17(12-22)18(13-23)20(16)25/h11,22-23H,3-10,12-13H2,1-2H3,(H,26,27)/b15-11+ |
| InChIKey | YKSKZRMUOSKBOG-RVDMUPIBSA-N |
| XLogP | 2.89 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|