C24H40O6 — CID 143782707
(2E)-2-[(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)methylidene]undecanal;ethane;methanol (PubChem CID 143782707) has the molecular formula C24H40O6 and a molecular weight of 424.58 g/mol. Its IUPAC name is (2E)-2-[(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)methylidene]undecanal;ethane;methanol.
| Compound Name | (2E)-2-[(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)methylidene]undecanal;ethane;methanol |
|---|---|
| PubChem CID | 143782707 |
| Molecular Formula | C24H40O6 |
| Molecular Weight | 424.58 g/mol |
| Exact Mass | 424.28 |
| IUPAC Name | (2E)-2-[(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)methylidene]undecanal;ethane;methanol |
| SMILES | CC.CCCCCCCCC/C(C=O)=C\C1=C(C)C(=O)C(OC)=C(OC)C1=O.CO |
| InChI | InChI=1S/C21H30O5.C2H6.CH4O/c1-5-6-7-8-9-10-11-12-16(14-22)13-17-15(2)18(23)20(25-3)21(26-4)19(17)24;2*1-2/h13-14H,5-12H2,1-4H3;1-2H3;2H,1H3/b16-13+;; |
| InChIKey | ALIOXKUDPNRGMM-YNHPUKFJSA-N |
| XLogP | 4.86 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.58 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|