C14H28N4O4 — CID 169025383
(2S)-6-[[4-(2-hydroxyethyl)piperazine-1-carbonyl]amino]-2-(methylamino)hexanoic acid (PubChem CID 169025383) has the molecular formula C14H28N4O4 and a molecular weight of 316.40 g/mol. Its IUPAC name is (2S)-6-[[4-(2-hydroxyethyl)piperazine-1-carbonyl]amino]-2-(methylamino)hexanoic acid.
| Compound Name | (2S)-6-[[4-(2-hydroxyethyl)piperazine-1-carbonyl]amino]-2-(methylamino)hexanoic acid |
|---|---|
| PubChem CID | 169025383 |
| Molecular Formula | C14H28N4O4 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.21 |
| IUPAC Name | (2S)-6-[[4-(2-hydroxyethyl)piperazine-1-carbonyl]amino]-2-(methylamino)hexanoic acid |
| SMILES | CN[C@@H](CCCCNC(=O)N1CCN(CCO)CC1)C(=O)O |
| InChI | InChI=1S/C14H28N4O4/c1-15-12(13(20)21)4-2-3-5-16-14(22)18-8-6-17(7-9-18)10-11-19/h12,15,19H,2-11H2,1H3,(H,16,22)(H,20,21)/t12-/m0/s1 |
| InChIKey | UQOGWLJXZNAHCJ-LBPRGKRZSA-N |
| XLogP | -0.85 |
| TPSA | 105.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|