About CID 169033858
CID 169033858 (PubChem CID 169033858) has the molecular formula C65H43FN4O2Pt-2
and a molecular weight of 1126.16 g/mol.
Molecular Properties
| Compound Name | CID 169033858 |
| PubChem CID | 169033858 |
| Molecular Formula | C65H43FN4O2Pt-2 |
| Molecular Weight | 1126.16 g/mol |
| Exact Mass | 1125.30 |
| IUPAC Name | — |
| SMILES | Cc1cc2oc3c(-n4[c-][n+]5c6c(cccc64)-c4ccccc4-c4ccccc4-c4cccc(-c6ccccc6)c4-5)[c-]c(Oc4[c-]c5c(cc4)c4ccccc4n5-c4cc(C(C)(C)C)ccn4)cc3c2cc1F.[Pt] |
| InChI | InChI=1S/C65H43FN4O2.Pt/c1-39-32-60-53(37-55(39)66)54-34-43(71-42-28-29-50-49-22-12-13-26-56(49)70(58(50)35-42)61-33-41(30-31-67-61)65(2,3)4)36-59(64(54)72-60)68-38-69-62-44(40-16-6-5-7-17-40)23-14-24-51(62)47-20-10-8-18-45(47)46-19-9-11-21-48(46)52-25-15-27-57(68)63(52)69;/h5-34,37H,1-4H3;/q-2; |
| InChIKey | UZHBNYNEJZFHQG-UHFFFAOYSA-N |
| XLogP | 16.22 |
| TPSA | 49.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 73 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1126.16 |
| LogP ≤ 5 | 16.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze CID 169033858 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 169033858?
The IUPAC name of CID 169033858 (CID 169033858) is not available.
What is the SMILES notation for CID 169033858?
The canonical SMILES for CID 169033858 is Cc1cc2oc3c(-n4[c-][n+]5c6c(cccc64)-c4ccccc4-c4ccccc4-c4cccc(-c6ccccc6)c4-5)[c-]c(Oc4[c-]c5c(cc4)c4ccccc4n5-c4cc(C(C)(C)C)ccn4)cc3c2cc1F.[Pt].
What is the InChIKey of CID 169033858?
The InChIKey is UZHBNYNEJZFHQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C65H43FN4O2.Pt/c1-39-32-60-53(37-55(39)66)54-34-43(71-42-28-29-50-49-22-12-13-26-56(49)70(58(50)35-42)61-33-41(30-31-67-61)65(2,3)4)36-59(64(54)72-60)68-38-69-62-44(40-16-6-5-7-17-40)23-14-24-51(62)47-20-10-8-18-45(47)46-19-9-11-21-48(46)52-25-15-27-57(68)63(52)69;/h5-34,37H,1-4H3;/q-2;.
What are the key properties of CID 169033858?
CID 169033858 has a molecular weight of 1126.16 g/mol, XLogP of 16.22, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 169033858 is sourced from PubChem (CID 169033858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).