C9H6N4O4 — CID 169041191
N-(6-nitro-2-pyridinyl)-1,3-oxazole-4-carboxamide (PubChem CID 169041191) has the molecular formula C9H6N4O4 and a molecular weight of 234.17 g/mol. Its IUPAC name is N-(6-nitro-2-pyridinyl)-1,3-oxazole-4-carboxamide.
| Compound Name | N-(6-nitro-2-pyridinyl)-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 169041191 |
| Molecular Formula | C9H6N4O4 |
| Molecular Weight | 234.17 g/mol |
| Exact Mass | 234.04 |
| IUPAC Name | N-(6-nitro-2-pyridinyl)-1,3-oxazole-4-carboxamide |
| SMILES | O=C(Nc1cccc([N+](=O)[O-])n1)c1cocn1 |
| InChI | InChI=1S/C9H6N4O4/c14-9(6-4-17-5-10-6)12-7-2-1-3-8(11-7)13(15)16/h1-5H,(H,11,12,14) |
| InChIKey | SGVYYEXLWJWXEZ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.17 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|