C13H26N2O7 — CID 169042173
1-[1-[2-[2-(carboxyamino)propoxy]ethoxy]propan-2-yloxy]propan-2-ylcarbamic acid (PubChem CID 169042173) has the molecular formula C13H26N2O7 and a molecular weight of 322.36 g/mol. Its IUPAC name is 1-[1-[2-[2-(carboxyamino)propoxy]ethoxy]propan-2-yloxy]propan-2-ylcarbamic acid.
| Compound Name | 1-[1-[2-[2-(carboxyamino)propoxy]ethoxy]propan-2-yloxy]propan-2-ylcarbamic acid |
|---|---|
| PubChem CID | 169042173 |
| Molecular Formula | C13H26N2O7 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | 1-[1-[2-[2-(carboxyamino)propoxy]ethoxy]propan-2-yloxy]propan-2-ylcarbamic acid |
| SMILES | CC(COCCOCC(C)OCC(C)NC(=O)O)NC(=O)O |
| InChI | InChI=1S/C13H26N2O7/c1-9(14-12(16)17)6-20-4-5-21-8-11(3)22-7-10(2)15-13(18)19/h9-11,14-15H,4-8H2,1-3H3,(H,16,17)(H,18,19) |
| InChIKey | GRJHCBYIAXENIT-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 126.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|