C24H41N3O12 — CID 169008227
ethyl 2-[1-[2,3-bis[2-[(2-ethoxy-2-oxoacetyl)amino]propoxy]propoxy]propan-2-ylamino]-2-oxoacetate (PubChem CID 169008227) has the molecular formula C24H41N3O12 and a molecular weight of 563.60 g/mol. Its IUPAC name is ethyl 2-[1-[2,3-bis[2-[(2-ethoxy-2-oxoacetyl)amino]propoxy]propoxy]propan-2-ylamino]-2-oxoacetate.
| Compound Name | ethyl 2-[1-[2,3-bis[2-[(2-ethoxy-2-oxoacetyl)amino]propoxy]propoxy]propan-2-ylamino]-2-oxoacetate |
|---|---|
| PubChem CID | 169008227 |
| Molecular Formula | C24H41N3O12 |
| Molecular Weight | 563.60 g/mol |
| Exact Mass | 563.27 |
| IUPAC Name | ethyl 2-[1-[2,3-bis[2-[(2-ethoxy-2-oxoacetyl)amino]propoxy]propoxy]propan-2-ylamino]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)NC(C)COCC(COCC(C)NC(=O)C(=O)OCC)OCC(C)NC(=O)C(=O)OCC |
| InChI | InChI=1S/C24H41N3O12/c1-7-36-22(31)19(28)25-15(4)10-34-13-18(39-12-17(6)27-21(30)24(33)38-9-3)14-35-11-16(5)26-20(29)23(32)37-8-2/h15-18H,7-14H2,1-6H3,(H,25,28)(H,26,29)(H,27,30) |
| InChIKey | UWXPZVWHKRBGJN-UHFFFAOYSA-N |
| XLogP | -1.39 |
| TPSA | 193.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.60 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|