C34H44N5O4+ — CID 169044157
[(1R,4E)-cyclooct-4-en-1-yl] N-[3-[4-(18-ethyl-2-oxa-12,18-diaza-6-azoniapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),3,5,9,11,14,19-heptaen-6-yl)butanoylamino]propyl]carbamate (PubChem CID 169044157) has the molecular formula C34H44N5O4+ and a molecular weight of 586.76 g/mol. Its IUPAC name is [(1R,4E)-cyclooct-4-en-1-yl] N-[3-[4-(18-ethyl-2-oxa-12,18-diaza-6-azoniapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),3,5,9,11,14,19-heptaen-6-yl)butanoylamino]propyl]carbamate.
| Compound Name | [(1R,4E)-cyclooct-4-en-1-yl] N-[3-[4-(18-ethyl-2-oxa-12,18-diaza-6-azoniapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),3,5,9,11,14,19-heptaen-6-yl)butanoylamino]propyl]carbamate |
|---|---|
| PubChem CID | 169044157 |
| Molecular Formula | C34H44N5O4+ |
| Molecular Weight | 586.76 g/mol |
| Exact Mass | 586.34 |
| IUPAC Name | [(1R,4E)-cyclooct-4-en-1-yl] N-[3-[4-(18-ethyl-2-oxa-12,18-diaza-6-azoniapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),3,5,9,11,14,19-heptaen-6-yl)butanoylamino]propyl]carbamate |
| SMILES | CCN1CCc2cc3c(cc21)Oc1cc2c(cc1=N3)CC[N+]=2CCCC(=O)NCCCNC(=O)O[C@H]1CC/C=C\CCC1 |
| InChI | InChI=1S/C34H43N5O4/c1-2-38-18-13-24-20-27-31(22-29(24)38)43-32-23-30-25(21-28(32)37-27)14-19-39(30)17-8-12-33(40)35-15-9-16-36-34(41)42-26-10-6-4-3-5-7-11-26/h3-4,20-23,26H,2,5-19H2,1H3,(H-,35,36,40,41)/p+1/b4-3-/t26-/m0/s1 |
| InChIKey | BIGXMKWWEUCBLL-JRPGADDVSA-O |
| XLogP | 4.07 |
| TPSA | 95.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.76 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|