C26H27N4O5+ — CID 169044175
(2,5-dioxopyrrolidin-1-yl) 4-(18-ethyl-2-oxa-12,18-diaza-6-azoniapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),3,5,9,11,14,19-heptaen-6-yl)butanoate (PubChem CID 169044175) has the molecular formula C26H27N4O5+ and a molecular weight of 475.53 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 4-(18-ethyl-2-oxa-12,18-diaza-6-azoniapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),3,5,9,11,14,19-heptaen-6-yl)butanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 4-(18-ethyl-2-oxa-12,18-diaza-6-azoniapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),3,5,9,11,14,19-heptaen-6-yl)butanoate |
|---|---|
| PubChem CID | 169044175 |
| Molecular Formula | C26H27N4O5+ |
| Molecular Weight | 475.53 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-(18-ethyl-2-oxa-12,18-diaza-6-azoniapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),3,5,9,11,14,19-heptaen-6-yl)butanoate |
| SMILES | CCN1CCc2cc3c(cc21)Oc1cc2c(cc1=N3)CC[N+]=2CCCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C26H27N4O5/c1-2-28-10-7-16-12-18-22(14-20(16)28)34-23-15-21-17(13-19(23)27-18)8-11-29(21)9-3-4-26(33)35-30-24(31)5-6-25(30)32/h12-15H,2-11H2,1H3/q+1 |
| InChIKey | FJROOFGCYXIHAD-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 91.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.53 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|