C26H27N4O10S+ — CID 169044240
1-[4-(20-ethyl-2,9,17-trioxa-13,20-diaza-6-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(22),3,5,10,12,14,16(21)-heptaen-6-yl)butanoyloxy]-2,5-dioxopyrrolidine-3-sulfonic acid (PubChem CID 169044240) has the molecular formula C26H27N4O10S+ and a molecular weight of 587.59 g/mol. Its IUPAC name is 1-[4-(20-ethyl-2,9,17-trioxa-13,20-diaza-6-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(22),3,5,10,12,14,16(21)-heptaen-6-yl)butanoyloxy]-2,5-dioxopyrrolidine-3-sulfonic acid.
| Compound Name | 1-[4-(20-ethyl-2,9,17-trioxa-13,20-diaza-6-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(22),3,5,10,12,14,16(21)-heptaen-6-yl)butanoyloxy]-2,5-dioxopyrrolidine-3-sulfonic acid |
|---|---|
| PubChem CID | 169044240 |
| Molecular Formula | C26H27N4O10S+ |
| Molecular Weight | 587.59 g/mol |
| Exact Mass | 587.14 |
| IUPAC Name | 1-[4-(20-ethyl-2,9,17-trioxa-13,20-diaza-6-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(22),3,5,10,12,14,16(21)-heptaen-6-yl)butanoyloxy]-2,5-dioxopyrrolidine-3-sulfonic acid |
| SMILES | CCN1CCOc2cc3c(cc21)Oc1cc2c(cc1=N3)OCC[N+]=2CCCC(=O)ON1C(=O)CC(S(=O)(=O)O)C1=O |
| InChI | InChI=1S/C26H26N4O10S/c1-2-28-6-8-37-21-10-15-19(12-17(21)28)39-20-13-18-22(11-16(20)27-15)38-9-7-29(18)5-3-4-25(32)40-30-24(31)14-23(26(30)33)41(34,35)36/h10-13,23H,2-9,14H2,1H3/p+1 |
| InChIKey | GCPXCDABVFZRHC-UHFFFAOYSA-O |
| XLogP | 0.10 |
| TPSA | 164.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.59 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|