C21H23N3O3 — CID 170222090
20-pentyl-2,9,17-trioxa-6,13,20-triazapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(22),3,5,10,12,14,16(21)-heptaene (PubChem CID 170222090) has the molecular formula C21H23N3O3 and a molecular weight of 365.43 g/mol. Its IUPAC name is 20-pentyl-2,9,17-trioxa-6,13,20-triazapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(22),3,5,10,12,14,16(21)-heptaene.
| Compound Name | 20-pentyl-2,9,17-trioxa-6,13,20-triazapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(22),3,5,10,12,14,16(21)-heptaene |
|---|---|
| PubChem CID | 170222090 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | 20-pentyl-2,9,17-trioxa-6,13,20-triazapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(22),3,5,10,12,14,16(21)-heptaene |
| SMILES | CCCCCN1CCOc2cc3c(cc21)Oc1cc2c(cc1=N3)OCCN=2 |
| InChI | InChI=1S/C21H23N3O3/c1-2-3-4-6-24-7-9-26-21-12-16-20(13-17(21)24)27-19-10-14-18(11-15(19)23-16)25-8-5-22-14/h10-13H,2-9H2,1H3 |
| InChIKey | FXQUGCHLKONMTB-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 55.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|