C20H18F5N3O3 — CID 169046977
4-[[(2S,3S,4R,5R)-3-(3,4-difluorophenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyridine-2-carboxamide (PubChem CID 169046977) has the molecular formula C20H18F5N3O3 and a molecular weight of 443.37 g/mol. Its IUPAC name is 4-[[(2S,3S,4R,5R)-3-(3,4-difluorophenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyridine-2-carboxamide.
| Compound Name | 4-[[(2S,3S,4R,5R)-3-(3,4-difluorophenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 169046977 |
| Molecular Formula | C20H18F5N3O3 |
| Molecular Weight | 443.37 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | 4-[[(2S,3S,4R,5R)-3-(3,4-difluorophenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyridine-2-carboxamide |
| SMILES | C[C@@H]1[C@@H](c2ccc(F)c(F)c2)[C@@H](C(=O)Nc2ccnc(C(N)=O)c2)O[C@@]1(C)C(F)(F)F |
| InChI | InChI=1S/C20H18F5N3O3/c1-9-15(10-3-4-12(21)13(22)7-10)16(31-19(9,2)20(23,24)25)18(30)28-11-5-6-27-14(8-11)17(26)29/h3-9,15-16H,1-2H3,(H2,26,29)(H,27,28,30)/t9-,15+,16+,19-/m1/s1 |
| InChIKey | PWSWIPCEIFQBIF-DNBXASARSA-N |
| XLogP | 3.54 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.37 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |