C21H19ClF5N3O4 — CID 169047000
4-[[(2S,3R,4R,5S)-3-(5-chloro-3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyridine-2-carboxamide (PubChem CID 169047000) has the molecular formula C21H19ClF5N3O4 and a molecular weight of 507.84 g/mol. Its IUPAC name is 4-[[(2S,3R,4R,5S)-3-(5-chloro-3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyridine-2-carboxamide.
| Compound Name | 4-[[(2S,3R,4R,5S)-3-(5-chloro-3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 169047000 |
| Molecular Formula | C21H19ClF5N3O4 |
| Molecular Weight | 507.84 g/mol |
| Exact Mass | 507.10 |
| IUPAC Name | 4-[[(2S,3R,4R,5S)-3-(5-chloro-3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyridine-2-carboxamide |
| SMILES | COc1c([C@@H]2[C@@H](C(=O)Nc3ccnc(C(N)=O)c3)O[C@](C)(C(F)(F)F)[C@@H]2C)cc(Cl)c(F)c1F |
| InChI | InChI=1S/C21H19ClF5N3O4/c1-8-13(10-7-11(22)14(23)15(24)16(10)33-3)17(34-20(8,2)21(25,26)27)19(32)30-9-4-5-29-12(6-9)18(28)31/h4-8,13,17H,1-3H3,(H2,28,31)(H,29,30,32)/t8-,13-,17+,20+/m1/s1 |
| InChIKey | ZHKBRBJYGGNJGP-AXJKXDTQSA-N |
| XLogP | 4.20 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.84 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|