C25H27F4N3O5 — CID 167221966
4-[[(2S,3R,4R,5S)-3-[4-(cyclopropylmethoxy)-3-fluoro-2-methoxyphenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyridine-2-carboxamide (PubChem CID 167221966) has the molecular formula C25H27F4N3O5 and a molecular weight of 525.50 g/mol. Its IUPAC name is 4-[[(2S,3R,4R,5S)-3-[4-(cyclopropylmethoxy)-3-fluoro-2-methoxyphenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyridine-2-carboxamide.
| Compound Name | 4-[[(2S,3R,4R,5S)-3-[4-(cyclopropylmethoxy)-3-fluoro-2-methoxyphenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 167221966 |
| Molecular Formula | C25H27F4N3O5 |
| Molecular Weight | 525.50 g/mol |
| Exact Mass | 525.19 |
| IUPAC Name | 4-[[(2S,3R,4R,5S)-3-[4-(cyclopropylmethoxy)-3-fluoro-2-methoxyphenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyridine-2-carboxamide |
| SMILES | COc1c([C@@H]2[C@@H](C(=O)Nc3ccnc(C(N)=O)c3)O[C@](C)(C(F)(F)F)[C@@H]2C)ccc(OCC2CC2)c1F |
| InChI | InChI=1S/C25H27F4N3O5/c1-12-18(15-6-7-17(19(26)20(15)35-3)36-11-13-4-5-13)21(37-24(12,2)25(27,28)29)23(34)32-14-8-9-31-16(10-14)22(30)33/h6-10,12-13,18,21H,4-5,11H2,1-3H3,(H2,30,33)(H,31,32,34)/t12-,18-,21+,24+/m1/s1 |
| InChIKey | YPZJQGRMZFNCPR-NVBWKWLKSA-N |
| XLogP | 4.20 |
| TPSA | 112.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.50 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |