C25H24F7N3O5 — CID 166159321
4-[[(2R,3S,4S,5R)-3-[5-(3,3-difluorocyclobutyl)oxy-3,4-difluoro-2-methoxyphenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyridine-2-carboxamide (PubChem CID 166159321) has the molecular formula C25H24F7N3O5 and a molecular weight of 579.47 g/mol. Its IUPAC name is 4-[[(2R,3S,4S,5R)-3-[5-(3,3-difluorocyclobutyl)oxy-3,4-difluoro-2-methoxyphenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyridine-2-carboxamide.
| Compound Name | 4-[[(2R,3S,4S,5R)-3-[5-(3,3-difluorocyclobutyl)oxy-3,4-difluoro-2-methoxyphenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 166159321 |
| Molecular Formula | C25H24F7N3O5 |
| Molecular Weight | 579.47 g/mol |
| Exact Mass | 579.16 |
| IUPAC Name | 4-[[(2R,3S,4S,5R)-3-[5-(3,3-difluorocyclobutyl)oxy-3,4-difluoro-2-methoxyphenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyridine-2-carboxamide |
| SMILES | COc1c([C@H]2[C@H](C(=O)Nc3ccnc(C(N)=O)c3)O[C@@](C)(C(F)(F)F)[C@H]2C)cc(OC2CC(F)(F)C2)c(F)c1F |
| InChI | InChI=1S/C25H24F7N3O5/c1-10-16(13-7-15(17(26)18(27)19(13)38-3)39-12-8-24(28,29)9-12)20(40-23(10,2)25(30,31)32)22(37)35-11-4-5-34-14(6-11)21(33)36/h4-7,10,12,16,20H,8-9H2,1-3H3,(H2,33,36)(H,34,35,37)/t10-,16-,20+,23+/m0/s1 |
| InChIKey | CKLKJYAIEONTNC-LTCKBHMDSA-N |
| XLogP | 4.72 |
| TPSA | 112.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.47 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |