C25H25F6N3O5 — CID 166159907
4-[[(2R,3S,4S,5R)-3-[4-(3,3-difluorocyclobutyl)oxy-3-fluoro-2-methoxyphenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyridine-2-carboxamide (PubChem CID 166159907) has the molecular formula C25H25F6N3O5 and a molecular weight of 561.48 g/mol. Its IUPAC name is 4-[[(2R,3S,4S,5R)-3-[4-(3,3-difluorocyclobutyl)oxy-3-fluoro-2-methoxyphenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyridine-2-carboxamide.
| Compound Name | 4-[[(2R,3S,4S,5R)-3-[4-(3,3-difluorocyclobutyl)oxy-3-fluoro-2-methoxyphenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 166159907 |
| Molecular Formula | C25H25F6N3O5 |
| Molecular Weight | 561.48 g/mol |
| Exact Mass | 561.17 |
| IUPAC Name | 4-[[(2R,3S,4S,5R)-3-[4-(3,3-difluorocyclobutyl)oxy-3-fluoro-2-methoxyphenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyridine-2-carboxamide |
| SMILES | COc1c([C@H]2[C@H](C(=O)Nc3ccnc(C(N)=O)c3)O[C@@](C)(C(F)(F)F)[C@H]2C)ccc(OC2CC(F)(F)C2)c1F |
| InChI | InChI=1S/C25H25F6N3O5/c1-11-17(14-4-5-16(18(26)19(14)37-3)38-13-9-24(27,28)10-13)20(39-23(11,2)25(29,30)31)22(36)34-12-6-7-33-15(8-12)21(32)35/h4-8,11,13,17,20H,9-10H2,1-3H3,(H2,32,35)(H,33,34,36)/t11-,17-,20+,23+/m0/s1 |
| InChIKey | FMRGONOYBFRGLY-LBOCZGAHSA-N |
| XLogP | 4.58 |
| TPSA | 112.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.48 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |