C23H21F6N3O3 — CID 166159282
4-[[(2R,3S,4R,5S)-4,5-dimethyl-3-(1,1,7-trifluoro-2,3-dihydroinden-4-yl)-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyridine-2-carboxamide (PubChem CID 166159282) has the molecular formula C23H21F6N3O3 and a molecular weight of 501.43 g/mol. Its IUPAC name is 4-[[(2R,3S,4R,5S)-4,5-dimethyl-3-(1,1,7-trifluoro-2,3-dihydroinden-4-yl)-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyridine-2-carboxamide.
| Compound Name | 4-[[(2R,3S,4R,5S)-4,5-dimethyl-3-(1,1,7-trifluoro-2,3-dihydroinden-4-yl)-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 166159282 |
| Molecular Formula | C23H21F6N3O3 |
| Molecular Weight | 501.43 g/mol |
| Exact Mass | 501.15 |
| IUPAC Name | 4-[[(2R,3S,4R,5S)-4,5-dimethyl-3-(1,1,7-trifluoro-2,3-dihydroinden-4-yl)-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyridine-2-carboxamide |
| SMILES | C[C@@H]1[C@@H](c2ccc(F)c3c2CCC3(F)F)[C@H](C(=O)Nc2ccnc(C(N)=O)c2)O[C@]1(C)C(F)(F)F |
| InChI | InChI=1S/C23H21F6N3O3/c1-10-16(12-3-4-14(24)17-13(12)5-7-22(17,25)26)18(35-21(10,2)23(27,28)29)20(34)32-11-6-8-31-15(9-11)19(30)33/h3-4,6,8-10,16,18H,5,7H2,1-2H3,(H2,30,33)(H,31,32,34)/t10-,16+,18-,21+/m1/s1 |
| InChIKey | ZMFNAPURSKKNRG-JYNCKYNQSA-N |
| XLogP | 4.44 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.43 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |