C20H18F5N3O5 — CID 169047082
4-[(2S,3R,4R,5S)-3-(3,4-difluoro-2-hydroxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]imino-1-hydroxypyridine-2-carboxamide (PubChem CID 169047082) has the molecular formula C20H18F5N3O5 and a molecular weight of 475.37 g/mol. Its IUPAC name is 4-[(2S,3R,4R,5S)-3-(3,4-difluoro-2-hydroxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]imino-1-hydroxypyridine-2-carboxamide.
| Compound Name | 4-[(2S,3R,4R,5S)-3-(3,4-difluoro-2-hydroxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]imino-1-hydroxypyridine-2-carboxamide |
|---|---|
| PubChem CID | 169047082 |
| Molecular Formula | C20H18F5N3O5 |
| Molecular Weight | 475.37 g/mol |
| Exact Mass | 475.12 |
| IUPAC Name | 4-[(2S,3R,4R,5S)-3-(3,4-difluoro-2-hydroxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]imino-1-hydroxypyridine-2-carboxamide |
| SMILES | C[C@@H]1[C@H](c2ccc(F)c(F)c2O)[C@@H](C(=O)/N=c2\ccn(O)c(C(N)=O)c2)O[C@]1(C)C(F)(F)F |
| InChI | InChI=1S/C20H18F5N3O5/c1-8-13(10-3-4-11(21)14(22)15(10)29)16(33-19(8,2)20(23,24)25)18(31)27-9-5-6-28(32)12(7-9)17(26)30/h3-8,13,16,29,32H,1-2H3,(H2,26,30)/b27-9+/t8-,13-,16+,19+/m1/s1 |
| InChIKey | SZLILRLUNWKYJD-XPIWBIHJSA-N |
| XLogP | 2.38 |
| TPSA | 127.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.37 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|