C22H22F5N3O5 — CID 169046644
4-[(2R,3R,4R,5R)-3-(2-ethoxy-3,4-difluorophenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]imino-1-hydroxypyridine-2-carboxamide (PubChem CID 169046644) has the molecular formula C22H22F5N3O5 and a molecular weight of 503.42 g/mol. Its IUPAC name is 4-[(2R,3R,4R,5R)-3-(2-ethoxy-3,4-difluorophenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]imino-1-hydroxypyridine-2-carboxamide.
| Compound Name | 4-[(2R,3R,4R,5R)-3-(2-ethoxy-3,4-difluorophenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]imino-1-hydroxypyridine-2-carboxamide |
|---|---|
| PubChem CID | 169046644 |
| Molecular Formula | C22H22F5N3O5 |
| Molecular Weight | 503.42 g/mol |
| Exact Mass | 503.15 |
| IUPAC Name | 4-[(2R,3R,4R,5R)-3-(2-ethoxy-3,4-difluorophenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]imino-1-hydroxypyridine-2-carboxamide |
| SMILES | CCOc1c([C@H]2[C@@H](C)[C@](C)(C(F)(F)F)O[C@H]2C(=O)/N=c2\ccn(O)c(C(N)=O)c2)ccc(F)c1F |
| InChI | InChI=1S/C22H22F5N3O5/c1-4-34-17-12(5-6-13(23)16(17)24)15-10(2)21(3,22(25,26)27)35-18(15)20(32)29-11-7-8-30(33)14(9-11)19(28)31/h5-10,15,18,33H,4H2,1-3H3,(H2,28,31)/b29-11+/t10-,15-,18-,21-/m1/s1 |
| InChIKey | HHNGMRAGRSXZTB-ODWAYGLWSA-N |
| XLogP | 3.07 |
| TPSA | 116.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.42 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|