C28H25F5O4 — CID 156750332
benzyl (2S,3S,4S,5R)-3-(3,4-difluoro-2-phenylmethoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxylate (PubChem CID 156750332) has the molecular formula C28H25F5O4 and a molecular weight of 520.49 g/mol. Its IUPAC name is benzyl (2S,3S,4S,5R)-3-(3,4-difluoro-2-phenylmethoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxylate.
| Compound Name | benzyl (2S,3S,4S,5R)-3-(3,4-difluoro-2-phenylmethoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxylate |
|---|---|
| PubChem CID | 156750332 |
| Molecular Formula | C28H25F5O4 |
| Molecular Weight | 520.49 g/mol |
| Exact Mass | 520.17 |
| IUPAC Name | benzyl (2S,3S,4S,5R)-3-(3,4-difluoro-2-phenylmethoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxylate |
| SMILES | C[C@H]1[C@@H](c2ccc(F)c(F)c2OCc2ccccc2)[C@@H](C(=O)OCc2ccccc2)O[C@@]1(C)C(F)(F)F |
| InChI | InChI=1S/C28H25F5O4/c1-17-22(20-13-14-21(29)23(30)24(20)35-15-18-9-5-3-6-10-18)25(37-27(17,2)28(31,32)33)26(34)36-16-19-11-7-4-8-12-19/h3-14,17,22,25H,15-16H2,1-2H3/t17-,22-,25-,27+/m0/s1 |
| InChIKey | ZKKLEWKSJNNWTJ-SZZNSNADSA-N |
| XLogP | 6.73 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.49 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |