C23H23F5N2O4 — CID 167211857
(2R,3S,4S,5R)-3-[3,4-difluoro-2-(oxetan-3-ylmethoxy)phenyl]-4,5-dimethyl-N-pyridin-3-yl-5-(trifluoromethyl)oxolane-2-carboxamide (PubChem CID 167211857) has the molecular formula C23H23F5N2O4 and a molecular weight of 486.44 g/mol. Its IUPAC name is (2R,3S,4S,5R)-3-[3,4-difluoro-2-(oxetan-3-ylmethoxy)phenyl]-4,5-dimethyl-N-pyridin-3-yl-5-(trifluoromethyl)oxolane-2-carboxamide.
| Compound Name | (2R,3S,4S,5R)-3-[3,4-difluoro-2-(oxetan-3-ylmethoxy)phenyl]-4,5-dimethyl-N-pyridin-3-yl-5-(trifluoromethyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 167211857 |
| Molecular Formula | C23H23F5N2O4 |
| Molecular Weight | 486.44 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | (2R,3S,4S,5R)-3-[3,4-difluoro-2-(oxetan-3-ylmethoxy)phenyl]-4,5-dimethyl-N-pyridin-3-yl-5-(trifluoromethyl)oxolane-2-carboxamide |
| SMILES | C[C@H]1[C@@H](c2ccc(F)c(F)c2OCC2COC2)[C@H](C(=O)Nc2cccnc2)O[C@@]1(C)C(F)(F)F |
| InChI | InChI=1S/C23H23F5N2O4/c1-12-17(15-5-6-16(24)18(25)19(15)33-11-13-9-32-10-13)20(34-22(12,2)23(26,27)28)21(31)30-14-4-3-7-29-8-14/h3-8,12-13,17,20H,9-11H2,1-2H3,(H,30,31)/t12-,17-,20+,22+/m0/s1 |
| InChIKey | DLHMUTFPZQICFP-IEYSZXAASA-N |
| XLogP | 4.46 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.44 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |