C23H26F2N2O5 — CID 170407856
(2S,3R,4R)-N-(2-acetyl-1-hydroxy-4-pyridinylidene)-3-(2-ethoxy-3,4-difluorophenyl)-4,5,5-trimethyloxolane-2-carboxamide (PubChem CID 170407856) has the molecular formula C23H26F2N2O5 and a molecular weight of 448.47 g/mol. Its IUPAC name is (2S,3R,4R)-N-(2-acetyl-1-hydroxy-4-pyridinylidene)-3-(2-ethoxy-3,4-difluorophenyl)-4,5,5-trimethyloxolane-2-carboxamide.
| Compound Name | (2S,3R,4R)-N-(2-acetyl-1-hydroxy-4-pyridinylidene)-3-(2-ethoxy-3,4-difluorophenyl)-4,5,5-trimethyloxolane-2-carboxamide |
|---|---|
| PubChem CID | 170407856 |
| Molecular Formula | C23H26F2N2O5 |
| Molecular Weight | 448.47 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | (2S,3R,4R)-N-(2-acetyl-1-hydroxy-4-pyridinylidene)-3-(2-ethoxy-3,4-difluorophenyl)-4,5,5-trimethyloxolane-2-carboxamide |
| SMILES | CCOc1c([C@@H]2[C@@H](C(=O)/N=c3\ccn(O)c(C(C)=O)c3)OC(C)(C)[C@@H]2C)ccc(F)c1F |
| InChI | InChI=1S/C23H26F2N2O5/c1-6-31-20-15(7-8-16(24)19(20)25)18-12(2)23(4,5)32-21(18)22(29)26-14-9-10-27(30)17(11-14)13(3)28/h7-12,18,21,30H,6H2,1-5H3/b26-14+/t12-,18-,21+/m1/s1 |
| InChIKey | KBJHLICGIZJJEF-ZOYWFWEHSA-N |
| XLogP | 3.63 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.47 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|