C22H19F7N2O5 — CID 170407745
(2R,3R,4R,5S)-N-(2-acetyl-1-hydroxy-4-pyridinylidene)-3-[2-(difluoromethoxy)-3,4-difluorophenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide (PubChem CID 170407745) has the molecular formula C22H19F7N2O5 and a molecular weight of 524.39 g/mol. Its IUPAC name is (2R,3R,4R,5S)-N-(2-acetyl-1-hydroxy-4-pyridinylidene)-3-[2-(difluoromethoxy)-3,4-difluorophenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide.
| Compound Name | (2R,3R,4R,5S)-N-(2-acetyl-1-hydroxy-4-pyridinylidene)-3-[2-(difluoromethoxy)-3,4-difluorophenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 170407745 |
| Molecular Formula | C22H19F7N2O5 |
| Molecular Weight | 524.39 g/mol |
| Exact Mass | 524.12 |
| IUPAC Name | (2R,3R,4R,5S)-N-(2-acetyl-1-hydroxy-4-pyridinylidene)-3-[2-(difluoromethoxy)-3,4-difluorophenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide |
| SMILES | CC(=O)c1c/c(=N/C(=O)[C@@H]2O[C@](C)(C(F)(F)F)[C@H](C)[C@@H]2c2ccc(F)c(F)c2OC(F)F)ccn1O |
| InChI | InChI=1S/C22H19F7N2O5/c1-9-15(12-4-5-13(23)16(24)17(12)35-20(25)26)18(36-21(9,3)22(27,28)29)19(33)30-11-6-7-31(34)14(8-11)10(2)32/h4-9,15,18,20,34H,1-3H3/b30-11+/t9-,15-,18-,21+/m1/s1 |
| InChIKey | BPWVDVOBEMWFBO-DTGKXPPUSA-N |
| XLogP | 4.37 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.39 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|