C15H13F7O4 — CID 178075896
(2R,3S,4S,5R)-3-[2-[deuterio(difluoro)methoxy]-3,4-difluorophenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxylic acid (PubChem CID 178075896) has the molecular formula C15H13F7O4 and a molecular weight of 391.26 g/mol. Its IUPAC name is (2R,3S,4S,5R)-3-[2-[deuterio(difluoro)methoxy]-3,4-difluorophenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxylic acid.
| Compound Name | (2R,3S,4S,5R)-3-[2-[deuterio(difluoro)methoxy]-3,4-difluorophenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxylic acid |
|---|---|
| PubChem CID | 178075896 |
| Molecular Formula | C15H13F7O4 |
| Molecular Weight | 391.26 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | (2R,3S,4S,5R)-3-[2-[deuterio(difluoro)methoxy]-3,4-difluorophenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxylic acid |
| SMILES | [2H]C(F)(F)Oc1c([C@H]2[C@H](C(=O)O)O[C@@](C)(C(F)(F)F)[C@H]2C)ccc(F)c1F |
| InChI | InChI=1S/C15H13F7O4/c1-5-8(11(12(23)24)26-14(5,2)15(20,21)22)6-3-4-7(16)9(17)10(6)25-13(18)19/h3-5,8,11,13H,1-2H3,(H,23,24)/t5-,8-,11+,14+/m0/s1/i13D |
| InChIKey | WQHFSSWIQBAEPE-NQKIHSDSSA-N |
| XLogP | 4.09 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.26 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |