C22H32F4O5Si — CID 166159691
(2R,3S,4S,5R)-3-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-fluoro-2-methoxyphenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxylic acid (PubChem CID 166159691) has the molecular formula C22H32F4O5Si and a molecular weight of 480.57 g/mol. Its IUPAC name is (2R,3S,4S,5R)-3-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-fluoro-2-methoxyphenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxylic acid.
| Compound Name | (2R,3S,4S,5R)-3-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-fluoro-2-methoxyphenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxylic acid |
|---|---|
| PubChem CID | 166159691 |
| Molecular Formula | C22H32F4O5Si |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | (2R,3S,4S,5R)-3-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-fluoro-2-methoxyphenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxylic acid |
| SMILES | COc1c([C@H]2[C@H](C(=O)O)O[C@@](C)(C(F)(F)F)[C@H]2C)ccc(F)c1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H32F4O5Si/c1-12-16(18(19(27)28)31-21(12,5)22(24,25)26)13-9-10-15(23)14(17(13)29-6)11-30-32(7,8)20(2,3)4/h9-10,12,16,18H,11H2,1-8H3,(H,27,28)/t12-,16-,18+,21+/m0/s1 |
| InChIKey | NILWVBPNOYLZMP-VLTYUJECSA-N |
| XLogP | 5.88 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|